C12H16N4OS — CID 63313641
[4-methyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]methanamine (PubChem CID 63313641) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is [4-methyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [4-methyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 63313641 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | [4-methyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]methanamine |
| SMILES | Cn1c(CN)nnc1SCCOc1ccccc1 |
| InChI | InChI=1S/C12H16N4OS/c1-16-11(9-13)14-15-12(16)18-8-7-17-10-5-3-2-4-6-10/h2-6H,7-9,13H2,1H3 |
| InChIKey | HMWQVTNEPMUQBU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|