C11H22N4O3S — CID 104563720
[5-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]methanamine (PubChem CID 104563720) has the molecular formula C11H22N4O3S and a molecular weight of 290.39 g/mol. Its IUPAC name is [5-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [5-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 104563720 |
| Molecular Formula | C11H22N4O3S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | [5-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]methanamine |
| SMILES | COCCOCCOCCSc1nnc(CN)n1C |
| InChI | InChI=1S/C11H22N4O3S/c1-15-10(9-12)13-14-11(15)19-8-7-18-6-5-17-4-3-16-2/h3-9,12H2,1-2H3 |
| InChIKey | LOZXFNDSNYXXQF-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|