C9H19ClN4O2S — CID 154904525
2-[2-[[5-(2-aminoethyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]ethanol;hydrochloride (PubChem CID 154904525) has the molecular formula C9H19ClN4O2S and a molecular weight of 282.80 g/mol. Its IUPAC name is 2-[2-[[5-(2-aminoethyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]ethanol;hydrochloride.
| Compound Name | 2-[2-[[5-(2-aminoethyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]ethanol;hydrochloride |
|---|---|
| PubChem CID | 154904525 |
| Molecular Formula | C9H19ClN4O2S |
| Molecular Weight | 282.80 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2-[2-[[5-(2-aminoethyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]ethanol;hydrochloride |
| SMILES | Cl.Cn1c(CCN)nnc1SCCOCCO |
| InChI | InChI=1S/C9H18N4O2S.ClH/c1-13-8(2-3-10)11-12-9(13)16-7-6-15-5-4-14;/h14H,2-7,10H2,1H3;1H |
| InChIKey | IYQBNDSZCNDYFV-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.80 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|