C7H13N3O3S — CID 62898655
3-[2-(2-hydroxyethoxy)ethylsulfanyl]-4-methyl-1H-1,2,4-triazol-5-one (PubChem CID 62898655) has the molecular formula C7H13N3O3S and a molecular weight of 219.27 g/mol. Its IUPAC name is 3-[2-(2-hydroxyethoxy)ethylsulfanyl]-4-methyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[2-(2-hydroxyethoxy)ethylsulfanyl]-4-methyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 62898655 |
| Molecular Formula | C7H13N3O3S |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 3-[2-(2-hydroxyethoxy)ethylsulfanyl]-4-methyl-1H-1,2,4-triazol-5-one |
| SMILES | Cn1c(SCCOCCO)n[nH]c1=O |
| InChI | InChI=1S/C7H13N3O3S/c1-10-6(12)8-9-7(10)14-5-4-13-3-2-11/h11H,2-5H2,1H3,(H,8,12) |
| InChIKey | AHEVTKYRDHNYNW-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|