C11H22N4O2S — CID 103180184
[4-ethyl-5-[2-(3-methoxypropoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]methanamine (PubChem CID 103180184) has the molecular formula C11H22N4O2S and a molecular weight of 274.39 g/mol. Its IUPAC name is [4-ethyl-5-[2-(3-methoxypropoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [4-ethyl-5-[2-(3-methoxypropoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 103180184 |
| Molecular Formula | C11H22N4O2S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | [4-ethyl-5-[2-(3-methoxypropoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]methanamine |
| SMILES | CCn1c(CN)nnc1SCCOCCCOC |
| InChI | InChI=1S/C11H22N4O2S/c1-3-15-10(9-12)13-14-11(15)18-8-7-17-6-4-5-16-2/h3-9,12H2,1-2H3 |
| InChIKey | LKZZBNBDSXDGQN-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|