C11H22N4S2 — CID 114271321
[5-(2-tert-butylsulfanylethylsulfanyl)-4-ethyl-1,2,4-triazol-3-yl]methanamine (PubChem CID 114271321) has the molecular formula C11H22N4S2 and a molecular weight of 274.46 g/mol. Its IUPAC name is [5-(2-tert-butylsulfanylethylsulfanyl)-4-ethyl-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [5-(2-tert-butylsulfanylethylsulfanyl)-4-ethyl-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 114271321 |
| Molecular Formula | C11H22N4S2 |
| Molecular Weight | 274.46 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | [5-(2-tert-butylsulfanylethylsulfanyl)-4-ethyl-1,2,4-triazol-3-yl]methanamine |
| SMILES | CCn1c(CN)nnc1SCCSC(C)(C)C |
| InChI | InChI=1S/C11H22N4S2/c1-5-15-9(8-12)13-14-10(15)16-6-7-17-11(2,3)4/h5-8,12H2,1-4H3 |
| InChIKey | WRYDFGNLKADPGD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|