C19H21BrN4O3S2 — CID 3731793
4-bromo-N-[[4-ethyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]methyl]benzenesulfonamide (PubChem CID 3731793) has the molecular formula C19H21BrN4O3S2 and a molecular weight of 497.44 g/mol. Its IUPAC name is 4-bromo-N-[[4-ethyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]methyl]benzenesulfonamide.
| Compound Name | 4-bromo-N-[[4-ethyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3731793 |
| Molecular Formula | C19H21BrN4O3S2 |
| Molecular Weight | 497.44 g/mol |
| Exact Mass | 496.02 |
| IUPAC Name | 4-bromo-N-[[4-ethyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]methyl]benzenesulfonamide |
| SMILES | CCn1c(CNS(=O)(=O)c2ccc(Br)cc2)nnc1SCCOc1ccccc1 |
| InChI | InChI=1S/C19H21BrN4O3S2/c1-2-24-18(14-21-29(25,26)17-10-8-15(20)9-11-17)22-23-19(24)28-13-12-27-16-6-4-3-5-7-16/h3-11,21H,2,12-14H2,1H3 |
| InChIKey | QKSUZNLJVQLYHF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|