C21H24N4O2S — CID 41019597
N-[(1R)-1-[4-ethyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 41019597) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is N-[(1R)-1-[4-ethyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | N-[(1R)-1-[4-ethyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 41019597 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-[(1R)-1-[4-ethyl-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | CCn1c(SCCOc2ccccc2)nnc1[C@@H](C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H24N4O2S/c1-3-25-19(16(2)22-20(26)17-10-6-4-7-11-17)23-24-21(25)28-15-14-27-18-12-8-5-9-13-18/h4-13,16H,3,14-15H2,1-2H3,(H,22,26)/t16-/m1/s1 |
| InChIKey | KWVHHIJQTYJOOA-MRXNPFEDSA-N |
| XLogP | 3.96 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|