C26H25FN4O2S — CID 42482783
N-[(1S)-1-[5-[2-(4-fluorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]ethyl]-4-phenylbenzamide (PubChem CID 42482783) has the molecular formula C26H25FN4O2S and a molecular weight of 476.58 g/mol. Its IUPAC name is N-[(1S)-1-[5-[2-(4-fluorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]ethyl]-4-phenylbenzamide.
| Compound Name | N-[(1S)-1-[5-[2-(4-fluorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]ethyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 42482783 |
| Molecular Formula | C26H25FN4O2S |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | N-[(1S)-1-[5-[2-(4-fluorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]ethyl]-4-phenylbenzamide |
| SMILES | C[C@H](NC(=O)c1ccc(-c2ccccc2)cc1)c1nnc(SCCOc2ccc(F)cc2)n1C |
| InChI | InChI=1S/C26H25FN4O2S/c1-18(28-25(32)21-10-8-20(9-11-21)19-6-4-3-5-7-19)24-29-30-26(31(24)2)34-17-16-33-23-14-12-22(27)13-15-23/h3-15,18H,16-17H2,1-2H3,(H,28,32)/t18-/m0/s1 |
| InChIKey | MLHDRDJLAGBZAJ-SFHVURJKSA-N |
| XLogP | 5.28 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|