C24H26FN5O3S — CID 42371846
N-[(1R)-1-[5-[2-(4-fluorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]ethyl]-4-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 42371846) has the molecular formula C24H26FN5O3S and a molecular weight of 483.57 g/mol. Its IUPAC name is N-[(1R)-1-[5-[2-(4-fluorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]ethyl]-4-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[(1R)-1-[5-[2-(4-fluorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]ethyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 42371846 |
| Molecular Formula | C24H26FN5O3S |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | N-[(1R)-1-[5-[2-(4-fluorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]ethyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(N2CCCC2=O)cc1)c1nnc(SCCOc2ccc(F)cc2)n1C |
| InChI | InChI=1S/C24H26FN5O3S/c1-16(26-23(32)17-5-9-19(10-6-17)30-13-3-4-21(30)31)22-27-28-24(29(22)2)34-15-14-33-20-11-7-18(25)8-12-20/h5-12,16H,3-4,13-15H2,1-2H3,(H,26,32)/t16-/m1/s1 |
| InChIKey | FWJJSLUQUPIPGV-MRXNPFEDSA-N |
| XLogP | 3.74 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|