C13H18N4S2 — CID 79222820
2-[3-methyl-5-(2-phenylsulfanylethylsulfanyl)-1,2,4-triazol-4-yl]ethanamine (PubChem CID 79222820) has the molecular formula C13H18N4S2 and a molecular weight of 294.45 g/mol. Its IUPAC name is 2-[3-methyl-5-(2-phenylsulfanylethylsulfanyl)-1,2,4-triazol-4-yl]ethanamine.
| Compound Name | 2-[3-methyl-5-(2-phenylsulfanylethylsulfanyl)-1,2,4-triazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 79222820 |
| Molecular Formula | C13H18N4S2 |
| Molecular Weight | 294.45 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[3-methyl-5-(2-phenylsulfanylethylsulfanyl)-1,2,4-triazol-4-yl]ethanamine |
| SMILES | Cc1nnc(SCCSc2ccccc2)n1CCN |
| InChI | InChI=1S/C13H18N4S2/c1-11-15-16-13(17(11)8-7-14)19-10-9-18-12-5-3-2-4-6-12/h2-6H,7-10,14H2,1H3 |
| InChIKey | KULYAYFKSBXAJI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|