C12H23N5S — CID 65294883
2-[3-methyl-5-(3-pyrrolidin-1-ylpropylsulfanyl)-1,2,4-triazol-4-yl]ethanamine (PubChem CID 65294883) has the molecular formula C12H23N5S and a molecular weight of 269.42 g/mol. Its IUPAC name is 2-[3-methyl-5-(3-pyrrolidin-1-ylpropylsulfanyl)-1,2,4-triazol-4-yl]ethanamine.
| Compound Name | 2-[3-methyl-5-(3-pyrrolidin-1-ylpropylsulfanyl)-1,2,4-triazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 65294883 |
| Molecular Formula | C12H23N5S |
| Molecular Weight | 269.42 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 2-[3-methyl-5-(3-pyrrolidin-1-ylpropylsulfanyl)-1,2,4-triazol-4-yl]ethanamine |
| SMILES | Cc1nnc(SCCCN2CCCC2)n1CCN |
| InChI | InChI=1S/C12H23N5S/c1-11-14-15-12(17(11)9-5-13)18-10-4-8-16-6-2-3-7-16/h2-10,13H2,1H3 |
| InChIKey | FVFDEANDPXBBDB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.42 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|