C14H17ClKN3S — CID 101438311
potassium 5-butyl-4-[2-(4-chlorophenyl)ethyl]-1,2,4-triazole-3-thiolate (PubChem CID 101438311) has the molecular formula C14H17ClKN3S and a molecular weight of 333.93 g/mol. Its IUPAC name is potassium 5-butyl-4-[2-(4-chlorophenyl)ethyl]-1,2,4-triazole-3-thiolate.
| Compound Name | potassium 5-butyl-4-[2-(4-chlorophenyl)ethyl]-1,2,4-triazole-3-thiolate |
|---|---|
| PubChem CID | 101438311 |
| Molecular Formula | C14H17ClKN3S |
| Molecular Weight | 333.93 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | potassium 5-butyl-4-[2-(4-chlorophenyl)ethyl]-1,2,4-triazole-3-thiolate |
| SMILES | CCCCc1nnc([S-])n1CCc1ccc(Cl)cc1.[K+] |
| InChI | InChI=1S/C14H18ClN3S.K/c1-2-3-4-13-16-17-14(19)18(13)10-9-11-5-7-12(15)8-6-11;/h5-8H,2-4,9-10H2,1H3,(H,17,19);/q;+1/p-1 |
| InChIKey | FQUNLJWGRPAVKW-UHFFFAOYSA-M |
| XLogP | 0.43 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.93 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|