About 4-[3-(diethylazaniumyl)propyl]-5-propyl-1,2,4-triazole-3-thiolate
4-[3-(diethylazaniumyl)propyl]-5-propyl-1,2,4-triazole-3-thiolate (PubChem CID 29073214) has the molecular formula C12H24N4S
and a molecular weight of 256.42 g/mol. Its IUPAC name is 4-[3-(diethylazaniumyl)propyl]-5-propyl-1,2,4-triazole-3-thiolate.
Molecular Properties
| Compound Name | 4-[3-(diethylazaniumyl)propyl]-5-propyl-1,2,4-triazole-3-thiolate |
| PubChem CID | 29073214 |
| Molecular Formula | C12H24N4S |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 4-[3-(diethylazaniumyl)propyl]-5-propyl-1,2,4-triazole-3-thiolate |
| SMILES | CCCc1nnc([S-])n1CCC[NH+](CC)CC |
| InChI | InChI=1S/C12H24N4S/c1-4-8-11-13-14-12(17)16(11)10-7-9-15(5-2)6-3/h4-10H2,1-3H3,(H,14,17) |
| InChIKey | GWWZRTYOOAYPEI-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 35.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(diethylazaniumyl)propyl]-5-propyl-1,2,4-triazole-3-thiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(diethylazaniumyl)propyl]-5-propyl-1,2,4-triazole-3-thiolate?
The IUPAC name of 4-[3-(diethylazaniumyl)propyl]-5-propyl-1,2,4-triazole-3-thiolate (CID 29073214) is 4-[3-(diethylazaniumyl)propyl]-5-propyl-1,2,4-triazole-3-thiolate.
What is the SMILES notation for 4-[3-(diethylazaniumyl)propyl]-5-propyl-1,2,4-triazole-3-thiolate?
The canonical SMILES for 4-[3-(diethylazaniumyl)propyl]-5-propyl-1,2,4-triazole-3-thiolate is CCCc1nnc([S-])n1CCC[NH+](CC)CC.
What is the InChIKey of 4-[3-(diethylazaniumyl)propyl]-5-propyl-1,2,4-triazole-3-thiolate?
The InChIKey is GWWZRTYOOAYPEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N4S/c1-4-8-11-13-14-12(17)16(11)10-7-9-15(5-2)6-3/h4-10H2,1-3H3,(H,14,17).
What are the key properties of 4-[3-(diethylazaniumyl)propyl]-5-propyl-1,2,4-triazole-3-thiolate?
4-[3-(diethylazaniumyl)propyl]-5-propyl-1,2,4-triazole-3-thiolate has a molecular weight of 256.42 g/mol, XLogP of 0.45, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(diethylazaniumyl)propyl]-5-propyl-1,2,4-triazole-3-thiolate is sourced from PubChem (CID 29073214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).