C11H19N3 — CID 144754875
3-cyclopropyl-4,5-dipropyl-1,2,4-triazole (PubChem CID 144754875) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 3-cyclopropyl-4,5-dipropyl-1,2,4-triazole.
| Compound Name | 3-cyclopropyl-4,5-dipropyl-1,2,4-triazole |
|---|---|
| PubChem CID | 144754875 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 3-cyclopropyl-4,5-dipropyl-1,2,4-triazole |
| SMILES | CCCc1nnc(C2CC2)n1CCC |
| InChI | InChI=1S/C11H19N3/c1-3-5-10-12-13-11(9-6-7-9)14(10)8-4-2/h9H,3-8H2,1-2H3 |
| InChIKey | TWZXWARHXNMJOH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |