C10H16ClN3O — CID 115398211
3-(chloromethyl)-5-(oxolan-2-yl)-4-propyl-1,2,4-triazole (PubChem CID 115398211) has the molecular formula C10H16ClN3O and a molecular weight of 229.71 g/mol. Its IUPAC name is 3-(chloromethyl)-5-(oxolan-2-yl)-4-propyl-1,2,4-triazole.
| Compound Name | 3-(chloromethyl)-5-(oxolan-2-yl)-4-propyl-1,2,4-triazole |
|---|---|
| PubChem CID | 115398211 |
| Molecular Formula | C10H16ClN3O |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 3-(chloromethyl)-5-(oxolan-2-yl)-4-propyl-1,2,4-triazole |
| SMILES | CCCn1c(CCl)nnc1C1CCCO1 |
| InChI | InChI=1S/C10H16ClN3O/c1-2-5-14-9(7-11)12-13-10(14)8-4-3-6-15-8/h8H,2-7H2,1H3 |
| InChIKey | IIXMGAVHXZTSFJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|