C13H22ClN3 — CID 106829442
3-(chloromethyl)-5-(1-methylcyclohexyl)-4-propyl-1,2,4-triazole (PubChem CID 106829442) has the molecular formula C13H22ClN3 and a molecular weight of 255.79 g/mol. Its IUPAC name is 3-(chloromethyl)-5-(1-methylcyclohexyl)-4-propyl-1,2,4-triazole.
| Compound Name | 3-(chloromethyl)-5-(1-methylcyclohexyl)-4-propyl-1,2,4-triazole |
|---|---|
| PubChem CID | 106829442 |
| Molecular Formula | C13H22ClN3 |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 3-(chloromethyl)-5-(1-methylcyclohexyl)-4-propyl-1,2,4-triazole |
| SMILES | CCCn1c(CCl)nnc1C1(C)CCCCC1 |
| InChI | InChI=1S/C13H22ClN3/c1-3-9-17-11(10-14)15-16-12(17)13(2)7-5-4-6-8-13/h3-10H2,1-2H3 |
| InChIKey | LTZRQLCAQURWOC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|