C14H24BrN3 — CID 106829451
3-(bromomethyl)-5-(1-methylcyclohexyl)-4-(2-methylpropyl)-1,2,4-triazole (PubChem CID 106829451) has the molecular formula C14H24BrN3 and a molecular weight of 314.27 g/mol. Its IUPAC name is 3-(bromomethyl)-5-(1-methylcyclohexyl)-4-(2-methylpropyl)-1,2,4-triazole.
| Compound Name | 3-(bromomethyl)-5-(1-methylcyclohexyl)-4-(2-methylpropyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 106829451 |
| Molecular Formula | C14H24BrN3 |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 3-(bromomethyl)-5-(1-methylcyclohexyl)-4-(2-methylpropyl)-1,2,4-triazole |
| SMILES | CC(C)Cn1c(CBr)nnc1C1(C)CCCCC1 |
| InChI | InChI=1S/C14H24BrN3/c1-11(2)10-18-12(9-15)16-17-13(18)14(3)7-5-4-6-8-14/h11H,4-10H2,1-3H3 |
| InChIKey | VUIYWPKDURNLGY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|