C9H16N4O — CID 112596317
N,4-dimethyl-5-(oxan-2-yl)-1,2,4-triazol-3-amine (PubChem CID 112596317) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is N,4-dimethyl-5-(oxan-2-yl)-1,2,4-triazol-3-amine.
| Compound Name | N,4-dimethyl-5-(oxan-2-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 112596317 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | N,4-dimethyl-5-(oxan-2-yl)-1,2,4-triazol-3-amine |
| SMILES | CNc1nnc(C2CCCCO2)n1C |
| InChI | InChI=1S/C9H16N4O/c1-10-9-12-11-8(13(9)2)7-5-3-4-6-14-7/h7H,3-6H2,1-2H3,(H,10,12) |
| InChIKey | RNEOGXYQYRQLJC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |