C8H13N3O2 — CID 166247490
N-methyl-5-(oxan-2-yl)-1,3,4-oxadiazol-2-amine (PubChem CID 166247490) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is N-methyl-5-(oxan-2-yl)-1,3,4-oxadiazol-2-amine.
| Compound Name | N-methyl-5-(oxan-2-yl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 166247490 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | N-methyl-5-(oxan-2-yl)-1,3,4-oxadiazol-2-amine |
| SMILES | CNc1nnc(C2CCCCO2)o1 |
| InChI | InChI=1S/C8H13N3O2/c1-9-8-11-10-7(13-8)6-4-2-3-5-12-6/h6H,2-5H2,1H3,(H,9,11) |
| InChIKey | GFZANYZECDDCDH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |