C7H11N3O2 — CID 62213336
5-(oxan-2-yl)-1,3,4-oxadiazol-2-amine (PubChem CID 62213336) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is 5-(oxan-2-yl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(oxan-2-yl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 62213336 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 5-(oxan-2-yl)-1,3,4-oxadiazol-2-amine |
| SMILES | Nc1nnc(C2CCCCO2)o1 |
| InChI | InChI=1S/C7H11N3O2/c8-7-10-9-6(12-7)5-3-1-2-4-11-5/h5H,1-4H2,(H2,8,10) |
| InChIKey | OZVDJDBLFCDKGI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |