C10H13F3N2O4 — CID 166755407
2-[(2R)-oxan-2-yl]-5-[2-(trifluoromethoxy)ethoxy]-1,3,4-oxadiazole (PubChem CID 166755407) has the molecular formula C10H13F3N2O4 and a molecular weight of 282.22 g/mol. Its IUPAC name is 2-[(2R)-oxan-2-yl]-5-[2-(trifluoromethoxy)ethoxy]-1,3,4-oxadiazole.
| Compound Name | 2-[(2R)-oxan-2-yl]-5-[2-(trifluoromethoxy)ethoxy]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 166755407 |
| Molecular Formula | C10H13F3N2O4 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-[(2R)-oxan-2-yl]-5-[2-(trifluoromethoxy)ethoxy]-1,3,4-oxadiazole |
| SMILES | FC(F)(F)OCCOc1nnc([C@H]2CCCCO2)o1 |
| InChI | InChI=1S/C10H13F3N2O4/c11-10(12,13)18-6-5-17-9-15-14-8(19-9)7-3-1-2-4-16-7/h7H,1-6H2/t7-/m1/s1 |
| InChIKey | YKBUSUXPZXKYKD-SSDOTTSWSA-N |
| XLogP | 2.23 |
| TPSA | 66.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|