C20H20N2O3 — CID 126817969
2-(oxan-2-yl)-5-[(2-phenylphenoxy)methyl]-1,3,4-oxadiazole (PubChem CID 126817969) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-(oxan-2-yl)-5-[(2-phenylphenoxy)methyl]-1,3,4-oxadiazole.
| Compound Name | 2-(oxan-2-yl)-5-[(2-phenylphenoxy)methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 126817969 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2-(oxan-2-yl)-5-[(2-phenylphenoxy)methyl]-1,3,4-oxadiazole |
| SMILES | c1ccc(-c2ccccc2OCc2nnc(C3CCCCO3)o2)cc1 |
| InChI | InChI=1S/C20H20N2O3/c1-2-8-15(9-3-1)16-10-4-5-11-17(16)24-14-19-21-22-20(25-19)18-12-6-7-13-23-18/h1-5,8-11,18H,6-7,12-14H2 |
| InChIKey | FSHMHFIXOKEVGR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |