C17H20N2O3 — CID 129490163
2-[(2R)-oxan-2-yl]-5-[(2S,3S)-2-phenyloxolan-3-yl]-1,3,4-oxadiazole (PubChem CID 129490163) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-[(2R)-oxan-2-yl]-5-[(2S,3S)-2-phenyloxolan-3-yl]-1,3,4-oxadiazole.
| Compound Name | 2-[(2R)-oxan-2-yl]-5-[(2S,3S)-2-phenyloxolan-3-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 129490163 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2-[(2R)-oxan-2-yl]-5-[(2S,3S)-2-phenyloxolan-3-yl]-1,3,4-oxadiazole |
| SMILES | c1ccc([C@H]2OCC[C@@H]2c2nnc([C@H]3CCCCO3)o2)cc1 |
| InChI | InChI=1S/C17H20N2O3/c1-2-6-12(7-3-1)15-13(9-11-21-15)16-18-19-17(22-16)14-8-4-5-10-20-14/h1-3,6-7,13-15H,4-5,8-11H2/t13-,14+,15+/m0/s1 |
| InChIKey | SYQNOQAXXQSMRQ-RRFJBIMHSA-N |
| XLogP | 3.56 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |