C17H20N2O3 — CID 56784754
2-(oxolan-2-yl)-5-(4-phenyloxan-4-yl)-1,3,4-oxadiazole (PubChem CID 56784754) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-(oxolan-2-yl)-5-(4-phenyloxan-4-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(oxolan-2-yl)-5-(4-phenyloxan-4-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 56784754 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2-(oxolan-2-yl)-5-(4-phenyloxan-4-yl)-1,3,4-oxadiazole |
| SMILES | c1ccc(C2(c3nnc(C4CCCO4)o3)CCOCC2)cc1 |
| InChI | InChI=1S/C17H20N2O3/c1-2-5-13(6-3-1)17(8-11-20-12-9-17)16-19-18-15(22-16)14-7-4-10-21-14/h1-3,5-6,14H,4,7-12H2 |
| InChIKey | BAFBQAGJVUDECP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |