C14H14N2O3 — CID 166104460
5-(1-phenylcyclopentyl)-1,3,4-oxadiazole-2-carboxylic acid (PubChem CID 166104460) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 5-(1-phenylcyclopentyl)-1,3,4-oxadiazole-2-carboxylic acid.
| Compound Name | 5-(1-phenylcyclopentyl)-1,3,4-oxadiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 166104460 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 5-(1-phenylcyclopentyl)-1,3,4-oxadiazole-2-carboxylic acid |
| SMILES | O=C(O)c1nnc(C2(c3ccccc3)CCCC2)o1 |
| InChI | InChI=1S/C14H14N2O3/c17-12(18)11-15-16-13(19-11)14(8-4-5-9-14)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2,(H,17,18) |
| InChIKey | ZSANGHPEEULZFY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |