About ethane;methanol;(1-phenylcyclohexyl)benzene
ethane;methanol;(1-phenylcyclohexyl)benzene (PubChem CID 91580542) has the molecular formula C26H46O2
and a molecular weight of 390.65 g/mol. Its IUPAC name is ethane;methanol;(1-phenylcyclohexyl)benzene.
Molecular Properties
| Compound Name | ethane;methanol;(1-phenylcyclohexyl)benzene |
| PubChem CID | 91580542 |
| Molecular Formula | C26H46O2 |
| Molecular Weight | 390.65 g/mol |
| Exact Mass | 390.35 |
| IUPAC Name | ethane;methanol;(1-phenylcyclohexyl)benzene |
| SMILES | CC.CC.CC.CO.CO.c1ccc(C2(c3ccccc3)CCCCC2)cc1 |
| InChI | InChI=1S/C18H20.3C2H6.2CH4O/c1-4-10-16(11-5-1)18(14-8-3-9-15-18)17-12-6-2-7-13-17;5*1-2/h1-2,4-7,10-13H,3,8-9,14-15H2;3*1-2H3;2*2H,1H3 |
| InChIKey | BHMCXCXUYYZKQS-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.65 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;methanol;(1-phenylcyclohexyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanol;(1-phenylcyclohexyl)benzene?
The IUPAC name of ethane;methanol;(1-phenylcyclohexyl)benzene (CID 91580542) is ethane;methanol;(1-phenylcyclohexyl)benzene.
What is the SMILES notation for ethane;methanol;(1-phenylcyclohexyl)benzene?
The canonical SMILES for ethane;methanol;(1-phenylcyclohexyl)benzene is CC.CC.CC.CO.CO.c1ccc(C2(c3ccccc3)CCCCC2)cc1.
What is the InChIKey of ethane;methanol;(1-phenylcyclohexyl)benzene?
The InChIKey is BHMCXCXUYYZKQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20.3C2H6.2CH4O/c1-4-10-16(11-5-1)18(14-8-3-9-15-18)17-12-6-2-7-13-17;5*1-2/h1-2,4-7,10-13H,3,8-9,14-15H2;3*1-2H3;2*2H,1H3.
What are the key properties of ethane;methanol;(1-phenylcyclohexyl)benzene?
ethane;methanol;(1-phenylcyclohexyl)benzene has a molecular weight of 390.65 g/mol, XLogP of 7.23, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanol;(1-phenylcyclohexyl)benzene is sourced from PubChem (CID 91580542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).