About copper;1-phenylcyclohexan-1-ol
copper;1-phenylcyclohexan-1-ol (PubChem CID 174727157) has the molecular formula C12H16CuO
and a molecular weight of 239.80 g/mol. Its IUPAC name is copper;1-phenylcyclohexan-1-ol.
Molecular Properties
| Compound Name | copper;1-phenylcyclohexan-1-ol |
| PubChem CID | 174727157 |
| Molecular Formula | C12H16CuO |
| Molecular Weight | 239.80 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | copper;1-phenylcyclohexan-1-ol |
| SMILES | OC1(c2ccccc2)CCCCC1.[Cu] |
| InChI | InChI=1S/C12H16O.Cu/c13-12(9-5-2-6-10-12)11-7-3-1-4-8-11;/h1,3-4,7-8,13H,2,5-6,9-10H2; |
| InChIKey | QOIJVAGUUHWUOG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.80 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze copper;1-phenylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;1-phenylcyclohexan-1-ol?
The IUPAC name of copper;1-phenylcyclohexan-1-ol (CID 174727157) is copper;1-phenylcyclohexan-1-ol.
What is the SMILES notation for copper;1-phenylcyclohexan-1-ol?
The canonical SMILES for copper;1-phenylcyclohexan-1-ol is OC1(c2ccccc2)CCCCC1.[Cu].
What is the InChIKey of copper;1-phenylcyclohexan-1-ol?
The InChIKey is QOIJVAGUUHWUOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O.Cu/c13-12(9-5-2-6-10-12)11-7-3-1-4-8-11;/h1,3-4,7-8,13H,2,5-6,9-10H2;.
What are the key properties of copper;1-phenylcyclohexan-1-ol?
copper;1-phenylcyclohexan-1-ol has a molecular weight of 239.80 g/mol, XLogP of 2.84, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for copper;1-phenylcyclohexan-1-ol is sourced from PubChem (CID 174727157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).