C18H28N2OS3 — CID 174917912
dimethylcarbamothioyl N,N-dimethylcarbamodithioate;1-phenylcyclohexan-1-ol (PubChem CID 174917912) has the molecular formula C18H28N2OS3 and a molecular weight of 384.64 g/mol. Its IUPAC name is dimethylcarbamothioyl N,N-dimethylcarbamodithioate;1-phenylcyclohexan-1-ol.
| Compound Name | dimethylcarbamothioyl N,N-dimethylcarbamodithioate;1-phenylcyclohexan-1-ol |
|---|---|
| PubChem CID | 174917912 |
| Molecular Formula | C18H28N2OS3 |
| Molecular Weight | 384.64 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | dimethylcarbamothioyl N,N-dimethylcarbamodithioate;1-phenylcyclohexan-1-ol |
| SMILES | CN(C)C(=S)SC(=S)N(C)C.OC1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C12H16O.C6H12N2S3/c13-12(9-5-2-6-10-12)11-7-3-1-4-8-11;1-7(2)5(9)11-6(10)8(3)4/h1,3-4,7-8,13H,2,5-6,9-10H2;1-4H3 |
| InChIKey | ZZAWWJLPHAWIOU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.64 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|