C15H25N3O3 — CID 174473231
acetic acid;guanidine;1-phenylcyclohexan-1-ol (PubChem CID 174473231) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is acetic acid;guanidine;1-phenylcyclohexan-1-ol.
| Compound Name | acetic acid;guanidine;1-phenylcyclohexan-1-ol |
|---|---|
| PubChem CID | 174473231 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | acetic acid;guanidine;1-phenylcyclohexan-1-ol |
| SMILES | CC(=O)O.OC1(c2ccccc2)CCCCC1.[H]N=C(N)N |
| InChI | InChI=1S/C12H16O.C2H4O2.CH5N3/c13-12(9-5-2-6-10-12)11-7-3-1-4-8-11;1-2(3)4;2-1(3)4/h1,3-4,7-8,13H,2,5-6,9-10H2;1H3,(H,3,4);(H5,2,3,4) |
| InChIKey | SCOPUVSUWZZOTH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 133.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|