C14H18N4O — CID 21300164
5-(1-methyl-4-phenylpiperidin-4-yl)-1,3,4-oxadiazol-2-amine (PubChem CID 21300164) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 5-(1-methyl-4-phenylpiperidin-4-yl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(1-methyl-4-phenylpiperidin-4-yl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 21300164 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 5-(1-methyl-4-phenylpiperidin-4-yl)-1,3,4-oxadiazol-2-amine |
| SMILES | CN1CCC(c2ccccc2)(c2nnc(N)o2)CC1 |
| InChI | InChI=1S/C14H18N4O/c1-18-9-7-14(8-10-18,11-5-3-2-4-6-11)12-16-17-13(15)19-12/h2-6H,7-10H2,1H3,(H2,15,17) |
| InChIKey | MHRQSJMDHXFEHG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |