C11H11N3O — CID 62877248
5-(1-phenylcyclopropyl)-1,3,4-oxadiazol-2-amine (PubChem CID 62877248) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is 5-(1-phenylcyclopropyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(1-phenylcyclopropyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 62877248 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 5-(1-phenylcyclopropyl)-1,3,4-oxadiazol-2-amine |
| SMILES | Nc1nnc(C2(c3ccccc3)CC2)o1 |
| InChI | InChI=1S/C11H11N3O/c12-10-14-13-9(15-10)11(6-7-11)8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,12,14) |
| InChIKey | ZATFYTDKFCGNFC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |