C14H22N2O2 — CID 158339828
1-methyl-4-phenylazepane-4-carboxamide;hydrate (PubChem CID 158339828) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-methyl-4-phenylazepane-4-carboxamide;hydrate.
| Compound Name | 1-methyl-4-phenylazepane-4-carboxamide;hydrate |
|---|---|
| PubChem CID | 158339828 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-methyl-4-phenylazepane-4-carboxamide;hydrate |
| SMILES | CN1CCCC(C(N)=O)(c2ccccc2)CC1.O |
| InChI | InChI=1S/C14H20N2O.H2O/c1-16-10-5-8-14(9-11-16,13(15)17)12-6-3-2-4-7-12;/h2-4,6-7H,5,8-11H2,1H3,(H2,15,17);1H2 |
| InChIKey | GRAHJZVTGPKNCO-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |