C14H20N4O3S — CID 68641506
1-(N'-methylsulfonylcarbamimidoyl)-4-phenylpiperidine-4-carboxamide (PubChem CID 68641506) has the molecular formula C14H20N4O3S and a molecular weight of 324.41 g/mol. Its IUPAC name is 1-(N'-methylsulfonylcarbamimidoyl)-4-phenylpiperidine-4-carboxamide.
| Compound Name | 1-(N'-methylsulfonylcarbamimidoyl)-4-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 68641506 |
| Molecular Formula | C14H20N4O3S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 1-(N'-methylsulfonylcarbamimidoyl)-4-phenylpiperidine-4-carboxamide |
| SMILES | CS(=O)(=O)N=C(N)N1CCC(C(N)=O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C14H20N4O3S/c1-22(20,21)17-13(16)18-9-7-14(8-10-18,12(15)19)11-5-3-2-4-6-11/h2-6H,7-10H2,1H3,(H2,15,19)(H2,16,17) |
| InChIKey | OLHYJCAKFXHOHD-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|