About 1-(N'-methylsulfonylcarbamimidoyl)-4-phenylpiperidine-4-carboxamide
1-(N'-methylsulfonylcarbamimidoyl)-4-phenylpiperidine-4-carboxamide (PubChem CID 68641506) has the molecular formula C14H20N4O3S
and a molecular weight of 324.41 g/mol. Its IUPAC name is 1-(N'-methylsulfonylcarbamimidoyl)-4-phenylpiperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-(N'-methylsulfonylcarbamimidoyl)-4-phenylpiperidine-4-carboxamide |
| PubChem CID | 68641506 |
| Molecular Formula | C14H20N4O3S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 1-(N'-methylsulfonylcarbamimidoyl)-4-phenylpiperidine-4-carboxamide |
| SMILES | CS(=O)(=O)N=C(N)N1CCC(C(N)=O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C14H20N4O3S/c1-22(20,21)17-13(16)18-9-7-14(8-10-18,12(15)19)11-5-3-2-4-6-11/h2-6H,7-10H2,1H3,(H2,15,19)(H2,16,17) |
| InChIKey | OLHYJCAKFXHOHD-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(N'-methylsulfonylcarbamimidoyl)-4-phenylpiperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(N'-methylsulfonylcarbamimidoyl)-4-phenylpiperidine-4-carboxamide?
The IUPAC name of 1-(N'-methylsulfonylcarbamimidoyl)-4-phenylpiperidine-4-carboxamide (CID 68641506) is 1-(N'-methylsulfonylcarbamimidoyl)-4-phenylpiperidine-4-carboxamide.
What is the SMILES notation for 1-(N'-methylsulfonylcarbamimidoyl)-4-phenylpiperidine-4-carboxamide?
The canonical SMILES for 1-(N'-methylsulfonylcarbamimidoyl)-4-phenylpiperidine-4-carboxamide is CS(=O)(=O)N=C(N)N1CCC(C(N)=O)(c2ccccc2)CC1.
What is the InChIKey of 1-(N'-methylsulfonylcarbamimidoyl)-4-phenylpiperidine-4-carboxamide?
The InChIKey is OLHYJCAKFXHOHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4O3S/c1-22(20,21)17-13(16)18-9-7-14(8-10-18,12(15)19)11-5-3-2-4-6-11/h2-6H,7-10H2,1H3,(H2,15,19)(H2,16,17).
What are the key properties of 1-(N'-methylsulfonylcarbamimidoyl)-4-phenylpiperidine-4-carboxamide?
1-(N'-methylsulfonylcarbamimidoyl)-4-phenylpiperidine-4-carboxamide has a molecular weight of 324.41 g/mol, XLogP of -0.22, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(N'-methylsulfonylcarbamimidoyl)-4-phenylpiperidine-4-carboxamide is sourced from PubChem (CID 68641506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).