C16H17N3O2 — CID 116640865
4-amino-2-(1-phenylcyclopentyl)pyrimidine-5-carboxylic acid (PubChem CID 116640865) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 4-amino-2-(1-phenylcyclopentyl)pyrimidine-5-carboxylic acid.
| Compound Name | 4-amino-2-(1-phenylcyclopentyl)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 116640865 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 4-amino-2-(1-phenylcyclopentyl)pyrimidine-5-carboxylic acid |
| SMILES | Nc1nc(C2(c3ccccc3)CCCC2)ncc1C(=O)O |
| InChI | InChI=1S/C16H17N3O2/c17-13-12(14(20)21)10-18-15(19-13)16(8-4-5-9-16)11-6-2-1-3-7-11/h1-3,6-7,10H,4-5,8-9H2,(H,20,21)(H2,17,18,19) |
| InChIKey | IHRATXYBZBRVQS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |