C17H19N3O2 — CID 143562143
methyl 2-amino-4-(1-phenylcyclopentyl)pyrimidine-5-carboxylate (PubChem CID 143562143) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is methyl 2-amino-4-(1-phenylcyclopentyl)pyrimidine-5-carboxylate.
| Compound Name | methyl 2-amino-4-(1-phenylcyclopentyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 143562143 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | methyl 2-amino-4-(1-phenylcyclopentyl)pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cnc(N)nc1C1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C17H19N3O2/c1-22-15(21)13-11-19-16(18)20-14(13)17(9-5-6-10-17)12-7-3-2-4-8-12/h2-4,7-8,11H,5-6,9-10H2,1H3,(H2,18,19,20) |
| InChIKey | ZMKSKIUPOXKKHZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |