C8H11N3O3 — CID 14639204
methyl 2-amino-4-(methoxymethyl)pyrimidine-5-carboxylate (PubChem CID 14639204) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is methyl 2-amino-4-(methoxymethyl)pyrimidine-5-carboxylate.
| Compound Name | methyl 2-amino-4-(methoxymethyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 14639204 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | methyl 2-amino-4-(methoxymethyl)pyrimidine-5-carboxylate |
| SMILES | COCc1nc(N)ncc1C(=O)OC |
| InChI | InChI=1S/C8H11N3O3/c1-13-4-6-5(7(12)14-2)3-10-8(9)11-6/h3H,4H2,1-2H3,(H2,9,10,11) |
| InChIKey | VOBKDSOCDCXDDC-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |