C9H13N3O3 — CID 10679999
2-(dimethylamino)-4-(methoxymethyl)pyrimidine-5-carboxylic acid (PubChem CID 10679999) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is 2-(dimethylamino)-4-(methoxymethyl)pyrimidine-5-carboxylic acid.
| Compound Name | 2-(dimethylamino)-4-(methoxymethyl)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 10679999 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-(dimethylamino)-4-(methoxymethyl)pyrimidine-5-carboxylic acid |
| SMILES | COCc1nc(N(C)C)ncc1C(=O)O |
| InChI | InChI=1S/C9H13N3O3/c1-12(2)9-10-4-6(8(13)14)7(11-9)5-15-3/h4H,5H2,1-3H3,(H,13,14) |
| InChIKey | WTBFEGZAAAZKBU-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |