C19H20N2O3 — CID 134001978
methyl 6-[(1-phenylcyclobutyl)methylcarbamoyl]pyridine-3-carboxylate (PubChem CID 134001978) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is methyl 6-[(1-phenylcyclobutyl)methylcarbamoyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[(1-phenylcyclobutyl)methylcarbamoyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134001978 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | methyl 6-[(1-phenylcyclobutyl)methylcarbamoyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)NCC2(c3ccccc3)CCC2)nc1 |
| InChI | InChI=1S/C19H20N2O3/c1-24-18(23)14-8-9-16(20-12-14)17(22)21-13-19(10-5-11-19)15-6-3-2-4-7-15/h2-4,6-9,12H,5,10-11,13H2,1H3,(H,21,22) |
| InChIKey | RCQATZQZPRLROU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |