C16H14Cl2N2O — CID 46462401
5,6-dichloro-N-[(1-phenylcyclopropyl)methyl]pyridine-3-carboxamide (PubChem CID 46462401) has the molecular formula C16H14Cl2N2O and a molecular weight of 321.21 g/mol. Its IUPAC name is 5,6-dichloro-N-[(1-phenylcyclopropyl)methyl]pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-[(1-phenylcyclopropyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46462401 |
| Molecular Formula | C16H14Cl2N2O |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 5,6-dichloro-N-[(1-phenylcyclopropyl)methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCC1(c2ccccc2)CC1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2N2O/c17-13-8-11(9-19-14(13)18)15(21)20-10-16(6-7-16)12-4-2-1-3-5-12/h1-5,8-9H,6-7,10H2,(H,20,21) |
| InChIKey | RNRPHFRKSCRZPU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|