C19H20ClNO — CID 847347
2-chloro-N-[(1-phenylcyclopentyl)methyl]benzamide (PubChem CID 847347) has the molecular formula C19H20ClNO and a molecular weight of 313.83 g/mol. Its IUPAC name is 2-chloro-N-[(1-phenylcyclopentyl)methyl]benzamide.
| Compound Name | 2-chloro-N-[(1-phenylcyclopentyl)methyl]benzamide |
|---|---|
| PubChem CID | 847347 |
| Molecular Formula | C19H20ClNO |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-chloro-N-[(1-phenylcyclopentyl)methyl]benzamide |
| SMILES | O=C(NCC1(c2ccccc2)CCCC1)c1ccccc1Cl |
| InChI | InChI=1S/C19H20ClNO/c20-17-11-5-4-10-16(17)18(22)21-14-19(12-6-7-13-19)15-8-2-1-3-9-15/h1-5,8-11H,6-7,12-14H2,(H,21,22) |
| InChIKey | GJZJPATXQWTERB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |