C20H23N3O3 — CID 92635144
1-(2-amino-2-oxoethyl)-2-oxo-N-[(1-phenylcyclopentyl)methyl]pyridine-3-carboxamide (PubChem CID 92635144) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 1-(2-amino-2-oxoethyl)-2-oxo-N-[(1-phenylcyclopentyl)methyl]pyridine-3-carboxamide.
| Compound Name | 1-(2-amino-2-oxoethyl)-2-oxo-N-[(1-phenylcyclopentyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 92635144 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1-(2-amino-2-oxoethyl)-2-oxo-N-[(1-phenylcyclopentyl)methyl]pyridine-3-carboxamide |
| SMILES | NC(=O)Cn1cccc(C(=O)NCC2(c3ccccc3)CCCC2)c1=O |
| InChI | InChI=1S/C20H23N3O3/c21-17(24)13-23-12-6-9-16(19(23)26)18(25)22-14-20(10-4-5-11-20)15-7-2-1-3-8-15/h1-3,6-9,12H,4-5,10-11,13-14H2,(H2,21,24)(H,22,25) |
| InChIKey | PREVSXZWQOUUTB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |