C15H17N3 — CID 46734055
4-(1-phenylcyclopentyl)pyrimidin-2-amine (PubChem CID 46734055) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 4-(1-phenylcyclopentyl)pyrimidin-2-amine.
| Compound Name | 4-(1-phenylcyclopentyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 46734055 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 4-(1-phenylcyclopentyl)pyrimidin-2-amine |
| SMILES | Nc1nccc(C2(c3ccccc3)CCCC2)n1 |
| InChI | InChI=1S/C15H17N3/c16-14-17-11-8-13(18-14)15(9-4-5-10-15)12-6-2-1-3-7-12/h1-3,6-8,11H,4-5,9-10H2,(H2,16,17,18) |
| InChIKey | QIOYVRQRGLKSQL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |