C19H21N5 — CID 141163352
5-methyl-7-(1-phenylcyclopentyl)pyrido[2,3-d]pyrimidine-2,4-diamine (PubChem CID 141163352) has the molecular formula C19H21N5 and a molecular weight of 319.41 g/mol. Its IUPAC name is 5-methyl-7-(1-phenylcyclopentyl)pyrido[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 5-methyl-7-(1-phenylcyclopentyl)pyrido[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 141163352 |
| Molecular Formula | C19H21N5 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 5-methyl-7-(1-phenylcyclopentyl)pyrido[2,3-d]pyrimidine-2,4-diamine |
| SMILES | Cc1cc(C2(c3ccccc3)CCCC2)nc2nc(N)nc(N)c12 |
| InChI | InChI=1S/C19H21N5/c1-12-11-14(22-17-15(12)16(20)23-18(21)24-17)19(9-5-6-10-19)13-7-3-2-4-8-13/h2-4,7-8,11H,5-6,9-10H2,1H3,(H4,20,21,22,23,24) |
| InChIKey | BDQGTQIRMRSEIZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |