C8H12ClN3O2 — CID 125456872
5-[(2S,5S)-5-(chloromethyl)oxolan-2-yl]-N-methyl-1,3,4-oxadiazol-2-amine (PubChem CID 125456872) has the molecular formula C8H12ClN3O2 and a molecular weight of 217.66 g/mol. Its IUPAC name is 5-[(2S,5S)-5-(chloromethyl)oxolan-2-yl]-N-methyl-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-[(2S,5S)-5-(chloromethyl)oxolan-2-yl]-N-methyl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 125456872 |
| Molecular Formula | C8H12ClN3O2 |
| Molecular Weight | 217.66 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 5-[(2S,5S)-5-(chloromethyl)oxolan-2-yl]-N-methyl-1,3,4-oxadiazol-2-amine |
| SMILES | CNc1nnc([C@@H]2CC[C@@H](CCl)O2)o1 |
| InChI | InChI=1S/C8H12ClN3O2/c1-10-8-12-11-7(14-8)6-3-2-5(4-9)13-6/h5-6H,2-4H2,1H3,(H,10,12)/t5-,6-/m0/s1 |
| InChIKey | KPBDBCZXZYXLQK-WDSKDSINSA-N |
| XLogP | 1.57 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.66 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|