C9H14ClN3O3S — CID 79586280
3-chloro-N-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2-methylpropane-1-sulfonamide (PubChem CID 79586280) has the molecular formula C9H14ClN3O3S and a molecular weight of 279.75 g/mol. Its IUPAC name is 3-chloro-N-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2-methylpropane-1-sulfonamide.
| Compound Name | 3-chloro-N-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 79586280 |
| Molecular Formula | C9H14ClN3O3S |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 3-chloro-N-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-2-methylpropane-1-sulfonamide |
| SMILES | CC(CCl)CS(=O)(=O)Nc1nnc(C2CC2)o1 |
| InChI | InChI=1S/C9H14ClN3O3S/c1-6(4-10)5-17(14,15)13-9-12-11-8(16-9)7-2-3-7/h6-7H,2-5H2,1H3,(H,12,13) |
| InChIKey | XMHNVBYWVGOHBA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|