C3H4IN3O — CID 146438012
5-iodo-N-methyl-1,3,4-oxadiazol-2-amine (PubChem CID 146438012) has the molecular formula C3H4IN3O and a molecular weight of 224.99 g/mol. Its IUPAC name is 5-iodo-N-methyl-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-iodo-N-methyl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 146438012 |
| Molecular Formula | C3H4IN3O |
| Molecular Weight | 224.99 g/mol |
| Exact Mass | 224.94 |
| IUPAC Name | 5-iodo-N-methyl-1,3,4-oxadiazol-2-amine |
| SMILES | CNc1nnc(I)o1 |
| InChI | InChI=1S/C3H4IN3O/c1-5-3-7-6-2(4)8-3/h1H3,(H,5,7) |
| InChIKey | RORFLODZXHSJSD-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.99 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|