C5H7IN2O2 — CID 114771639
2-iodo-5-(2-methoxyethyl)-1,3,4-oxadiazole (PubChem CID 114771639) has the molecular formula C5H7IN2O2 and a molecular weight of 254.03 g/mol. Its IUPAC name is 2-iodo-5-(2-methoxyethyl)-1,3,4-oxadiazole.
| Compound Name | 2-iodo-5-(2-methoxyethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 114771639 |
| Molecular Formula | C5H7IN2O2 |
| Molecular Weight | 254.03 g/mol |
| Exact Mass | 253.96 |
| IUPAC Name | 2-iodo-5-(2-methoxyethyl)-1,3,4-oxadiazole |
| SMILES | COCCc1nnc(I)o1 |
| InChI | InChI=1S/C5H7IN2O2/c1-9-3-2-4-7-8-5(6)10-4/h2-3H2,1H3 |
| InChIKey | PRWVYIPAJPOTIG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.03 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|