C9H13IN2O2 — CID 114771865
2-iodo-5-[2-(oxan-2-yl)ethyl]-1,3,4-oxadiazole (PubChem CID 114771865) has the molecular formula C9H13IN2O2 and a molecular weight of 308.12 g/mol. Its IUPAC name is 2-iodo-5-[2-(oxan-2-yl)ethyl]-1,3,4-oxadiazole.
| Compound Name | 2-iodo-5-[2-(oxan-2-yl)ethyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 114771865 |
| Molecular Formula | C9H13IN2O2 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 2-iodo-5-[2-(oxan-2-yl)ethyl]-1,3,4-oxadiazole |
| SMILES | Ic1nnc(CCC2CCCCO2)o1 |
| InChI | InChI=1S/C9H13IN2O2/c10-9-12-11-8(14-9)5-4-7-3-1-2-6-13-7/h7H,1-6H2 |
| InChIKey | UEEYJUFZZSYUTD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|