C8H11IN2O2 — CID 112572494
3-iodo-5-[2-(oxolan-2-yl)ethyl]-1,2,4-oxadiazole (PubChem CID 112572494) has the molecular formula C8H11IN2O2 and a molecular weight of 294.09 g/mol. Its IUPAC name is 3-iodo-5-[2-(oxolan-2-yl)ethyl]-1,2,4-oxadiazole.
| Compound Name | 3-iodo-5-[2-(oxolan-2-yl)ethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 112572494 |
| Molecular Formula | C8H11IN2O2 |
| Molecular Weight | 294.09 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | 3-iodo-5-[2-(oxolan-2-yl)ethyl]-1,2,4-oxadiazole |
| SMILES | Ic1noc(CCC2CCCO2)n1 |
| InChI | InChI=1S/C8H11IN2O2/c9-8-10-7(13-11-8)4-3-6-2-1-5-12-6/h6H,1-5H2 |
| InChIKey | CKMMXZXLPDLQFR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.09 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|